C29H22N4O3 — CID 121049623
N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-9H-xanthene-9-carboxamide (PubChem CID 121049623) has the molecular formula C29H22N4O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 121049623 |
| Molecular Formula | C29H22N4O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(NCc1nn(Cc2cccnc2)c(=O)c2ccccc12)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C29H22N4O3/c34-28(27-22-11-3-5-13-25(22)36-26-14-6-4-12-23(26)27)31-17-24-20-9-1-2-10-21(20)29(35)33(32-24)18-19-8-7-15-30-16-19/h1-16,27H,17-18H2,(H,31,34) |
| InChIKey | ZBARGMCTOUXZOM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |