C23H20N4O3 — CID 121049579
N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-2-phenoxyacetamide (PubChem CID 121049579) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-2-phenoxyacetamide.
| Compound Name | N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 121049579 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCc1nn(Cc2cccnc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H20N4O3/c28-22(16-30-18-8-2-1-3-9-18)25-14-21-19-10-4-5-11-20(19)23(29)27(26-21)15-17-7-6-12-24-13-17/h1-13H,14-16H2,(H,25,28) |
| InChIKey | IHYLLXCBAOVVBF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |