C25H30N4O4 — CID 90490491
2-(4-ethoxyphenoxy)-N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]acetamide (PubChem CID 90490491) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 90490491 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)NCc2nn(CCN3CCCC3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-2-32-19-9-11-20(12-10-19)33-18-24(30)26-17-23-21-7-3-4-8-22(21)25(31)29(27-23)16-15-28-13-5-6-14-28/h3-4,7-12H,2,5-6,13-18H2,1H3,(H,26,30) |
| InChIKey | COFLPZYVTQCNPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |