About chlorobenzene;2-(sulfanylmethyl)butanoic acid
chlorobenzene;2-(sulfanylmethyl)butanoic acid (PubChem CID 175366985) has the molecular formula C11H15ClO2S
and a molecular weight of 246.76 g/mol. Its IUPAC name is chlorobenzene;2-(sulfanylmethyl)butanoic acid.
Molecular Properties
| Compound Name | chlorobenzene;2-(sulfanylmethyl)butanoic acid |
| PubChem CID | 175366985 |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | chlorobenzene;2-(sulfanylmethyl)butanoic acid |
| SMILES | CCC(CS)C(=O)O.Clc1ccccc1 |
| InChI | InChI=1S/C6H5Cl.C5H10O2S/c7-6-4-2-1-3-5-6;1-2-4(3-8)5(6)7/h1-5H;4,8H,2-3H2,1H3,(H,6,7) |
| InChIKey | BTWCJRJYCXKAKH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;2-(sulfanylmethyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;2-(sulfanylmethyl)butanoic acid?
The IUPAC name of chlorobenzene;2-(sulfanylmethyl)butanoic acid (CID 175366985) is chlorobenzene;2-(sulfanylmethyl)butanoic acid.
What is the SMILES notation for chlorobenzene;2-(sulfanylmethyl)butanoic acid?
The canonical SMILES for chlorobenzene;2-(sulfanylmethyl)butanoic acid is CCC(CS)C(=O)O.Clc1ccccc1.
What is the InChIKey of chlorobenzene;2-(sulfanylmethyl)butanoic acid?
The InChIKey is BTWCJRJYCXKAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl.C5H10O2S/c7-6-4-2-1-3-5-6;1-2-4(3-8)5(6)7/h1-5H;4,8H,2-3H2,1H3,(H,6,7).
What are the key properties of chlorobenzene;2-(sulfanylmethyl)butanoic acid?
chlorobenzene;2-(sulfanylmethyl)butanoic acid has a molecular weight of 246.76 g/mol, XLogP of 3.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;2-(sulfanylmethyl)butanoic acid is sourced from PubChem (CID 175366985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).