About acetic acid;chlorobenzene;thiophene
acetic acid;chlorobenzene;thiophene (PubChem CID 174583245) has the molecular formula C12H13ClO2S
and a molecular weight of 256.75 g/mol. Its IUPAC name is acetic acid;chlorobenzene;thiophene.
Molecular Properties
| Compound Name | acetic acid;chlorobenzene;thiophene |
| PubChem CID | 174583245 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | acetic acid;chlorobenzene;thiophene |
| SMILES | CC(=O)O.Clc1ccccc1.c1ccsc1 |
| InChI | InChI=1S/C6H5Cl.C4H4S.C2H4O2/c7-6-4-2-1-3-5-6;1-2-4-5-3-1;1-2(3)4/h1-5H;1-4H;1H3,(H,3,4) |
| InChIKey | DOAOQEXPJOCRDD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;chlorobenzene;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;chlorobenzene;thiophene?
The IUPAC name of acetic acid;chlorobenzene;thiophene (CID 174583245) is acetic acid;chlorobenzene;thiophene.
What is the SMILES notation for acetic acid;chlorobenzene;thiophene?
The canonical SMILES for acetic acid;chlorobenzene;thiophene is CC(=O)O.Clc1ccccc1.c1ccsc1.
What is the InChIKey of acetic acid;chlorobenzene;thiophene?
The InChIKey is DOAOQEXPJOCRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl.C4H4S.C2H4O2/c7-6-4-2-1-3-5-6;1-2-4-5-3-1;1-2(3)4/h1-5H;1-4H;1H3,(H,3,4).
What are the key properties of acetic acid;chlorobenzene;thiophene?
acetic acid;chlorobenzene;thiophene has a molecular weight of 256.75 g/mol, XLogP of 4.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;chlorobenzene;thiophene is sourced from PubChem (CID 174583245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).