C26H32BrO2P — CID 87799243
3,3-diethoxybutyl(triphenyl)phosphanium bromide (PubChem CID 87799243) has the molecular formula C26H32BrO2P and a molecular weight of 487.42 g/mol. Its IUPAC name is 3,3-diethoxybutyl(triphenyl)phosphanium bromide.
| Compound Name | 3,3-diethoxybutyl(triphenyl)phosphanium bromide |
|---|---|
| PubChem CID | 87799243 |
| Molecular Formula | C26H32BrO2P |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 3,3-diethoxybutyl(triphenyl)phosphanium bromide |
| SMILES | CCOC(C)(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCC.[Br-] |
| InChI | InChI=1S/C26H32O2P.BrH/c1-4-27-26(3,28-5-2)21-22-29(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25;/h6-20H,4-5,21-22H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QRTCLIALZZFLFZ-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|