C24H24F2O2P+ — CID 21329542
(5-carboxy-5,5-difluoropentyl)-triphenylphosphanium (PubChem CID 21329542) has the molecular formula C24H24F2O2P+ and a molecular weight of 413.42 g/mol. Its IUPAC name is (5-carboxy-5,5-difluoropentyl)-triphenylphosphanium.
| Compound Name | (5-carboxy-5,5-difluoropentyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 21329542 |
| Molecular Formula | C24H24F2O2P+ |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (5-carboxy-5,5-difluoropentyl)-triphenylphosphanium |
| SMILES | O=C(O)C(F)(F)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23F2O2P/c25-24(26,23(27)28)18-10-11-19-29(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-17H,10-11,18-19H2/p+1 |
| InChIKey | XXGCZEVCGKXERI-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|