C25H26F2O2P+ — CID 21401780
(6-carboxy-6,6-difluorohexyl)-triphenylphosphanium (PubChem CID 21401780) has the molecular formula C25H26F2O2P+ and a molecular weight of 427.45 g/mol. Its IUPAC name is (6-carboxy-6,6-difluorohexyl)-triphenylphosphanium.
| Compound Name | (6-carboxy-6,6-difluorohexyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 21401780 |
| Molecular Formula | C25H26F2O2P+ |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (6-carboxy-6,6-difluorohexyl)-triphenylphosphanium |
| SMILES | O=C(O)C(F)(F)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25F2O2P/c26-25(27,24(28)29)19-11-4-12-20-30(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2/p+1 |
| InChIKey | MYBSLSONXCNFPL-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|