C15H22N2 — CID 139678117
3,7-dimethyl-N-pyridin-2-yloct-6-en-1-imine (PubChem CID 139678117) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3,7-dimethyl-N-pyridin-2-yloct-6-en-1-imine.
| Compound Name | 3,7-dimethyl-N-pyridin-2-yloct-6-en-1-imine |
|---|---|
| PubChem CID | 139678117 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3,7-dimethyl-N-pyridin-2-yloct-6-en-1-imine |
| SMILES | CC(C)=CCCC(C)CC=Nc1ccccn1 |
| InChI | InChI=1S/C15H22N2/c1-13(2)7-6-8-14(3)10-12-17-15-9-4-5-11-16-15/h4-5,7,9,11-12,14H,6,8,10H2,1-3H3 |
| InChIKey | QFGMCWARVRLCMN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|