C17H23FN2O — CID 9236025
N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-2-fluorobenzamide (PubChem CID 9236025) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-2-fluorobenzamide.
| Compound Name | N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 9236025 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-2-fluorobenzamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=N\NC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H23FN2O/c1-13(2)7-6-8-14(3)11-12-19-20-17(21)15-9-4-5-10-16(15)18/h4-5,7,9-10,12,14H,6,8,11H2,1-3H3,(H,20,21)/b19-12-/t14-/m0/s1 |
| InChIKey | CSVIMWJMZTXAMH-YQNUULROSA-N |
| XLogP | 4.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|