About 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide
4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide (PubChem CID 9070857) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide.
Molecular Properties
| Compound Name | 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide |
| PubChem CID | 9070857 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=N\NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-13(2)5-4-6-14(3)11-12-19-20-17(21)15-7-9-16(18)10-8-15/h5,7-10,12,14H,4,6,11,18H2,1-3H3,(H,20,21)/b19-12-/t14-/m0/s1 |
| InChIKey | HWIGNAUPKPJFMC-YQNUULROSA-N |
| XLogP | 3.76 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide?
The IUPAC name of 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide (CID 9070857) is 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide.
What is the SMILES notation for 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide?
The canonical SMILES for 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide is CC(C)=CCC[C@H](C)C/C=N\NC(=O)c1ccc(N)cc1.
What is the InChIKey of 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide?
The InChIKey is HWIGNAUPKPJFMC-YQNUULROSA-N. The full InChI is InChI=1S/C17H25N3O/c1-13(2)5-4-6-14(3)11-12-19-20-17(21)15-7-9-16(18)10-8-15/h5,7-10,12,14H,4,6,11,18H2,1-3H3,(H,20,21)/b19-12-/t14-/m0/s1.
What are the key properties of 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide?
4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide has a molecular weight of 287.41 g/mol, XLogP of 3.76, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]benzamide is sourced from PubChem (CID 9070857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).