C19H24N4O2 — CID 9177014
N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9177014) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9177014 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CC(C)=CCC[C@@H](C)C/C=N\NC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H24N4O2/c1-13(2)7-6-8-14(3)11-12-20-22-19(25)17-15-9-4-5-10-16(15)18(24)23-21-17/h4-5,7,9-10,12,14H,6,8,11H2,1-3H3,(H,22,25)(H,23,24)/b20-12-/t14-/m1/s1 |
| InChIKey | PLCMPOYKIWJGGU-FAPYRAKZSA-N |
| XLogP | 3.41 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|