C19H27N3O2 — CID 9180117
N'-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N-(4-methylphenyl)oxamide (PubChem CID 9180117) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N'-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 9180117 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N'-[(Z)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N-(4-methylphenyl)oxamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=N\NC(=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-14(2)6-5-7-15(3)12-13-20-22-19(24)18(23)21-17-10-8-16(4)9-11-17/h6,8-11,13,15H,5,7,12H2,1-4H3,(H,21,23)(H,22,24)/b20-13-/t15-/m0/s1 |
| InChIKey | UTEQWWUKNDCRLN-HYTQYMIGSA-N |
| XLogP | 3.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|