C17H21ClN2O — CID 129460373
4-chloro-N-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]benzamide (PubChem CID 129460373) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-chloro-N-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]benzamide.
| Compound Name | 4-chloro-N-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]benzamide |
|---|---|
| PubChem CID | 129460373 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-chloro-N-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]benzamide |
| SMILES | CC(C)=CCC/C(C)=C/C=NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O/c1-13(2)5-4-6-14(3)11-12-19-20-17(21)15-7-9-16(18)10-8-15/h5,7-12H,4,6H2,1-3H3,(H,20,21)/b14-11+,19-12? |
| InChIKey | GSVCLZCYPBPQEA-XHOSPMEYSA-N |
| XLogP | 4.75 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|