C20H27N3O2 — CID 6135333
N-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-(propanoylamino)benzamide (PubChem CID 6135333) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-(propanoylamino)benzamide.
| Compound Name | N-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 6135333 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)N/N=C\C=C(/C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-5-19(24)22-18-11-9-17(10-12-18)20(25)23-21-14-13-16(4)8-6-7-15(2)3/h7,9-14H,5-6,8H2,1-4H3,(H,22,24)(H,23,25)/b16-13+,21-14- |
| InChIKey | BOHKKPWNPIOOBT-CQPDGHCISA-N |
| XLogP | 4.44 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|