About (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene
(6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene (PubChem CID 72722696) has the molecular formula C19H40N2Si
and a molecular weight of 324.63 g/mol. Its IUPAC name is (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene.
Molecular Properties
| Compound Name | (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene |
| PubChem CID | 72722696 |
| Molecular Formula | C19H40N2Si |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene |
| SMILES | CC(C)=CCC[C@H](C)C/C=N/N[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H40N2Si/c1-15(2)11-10-12-19(9)13-14-20-21-22(16(3)4,17(5)6)18(7)8/h11,14,16-19,21H,10,12-13H2,1-9H3/b20-14+/t19-/m0/s1 |
| InChIKey | LSNRUWGXEBWDCO-XPFMCRKWSA-N |
| XLogP | 6.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene?
The IUPAC name of (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene (CID 72722696) is (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene.
What is the SMILES notation for (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene?
The canonical SMILES for (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene is CC(C)=CCC[C@H](C)C/C=N/N[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene?
The InChIKey is LSNRUWGXEBWDCO-XPFMCRKWSA-N. The full InChI is InChI=1S/C19H40N2Si/c1-15(2)11-10-12-19(9)13-14-20-21-22(16(3)4,17(5)6)18(7)8/h11,14,16-19,21H,10,12-13H2,1-9H3/b20-14+/t19-/m0/s1.
What are the key properties of (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene?
(6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene has a molecular weight of 324.63 g/mol, XLogP of 6.51, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,8E)-2,6-dimethyl-8-[tri(propan-2-yl)silylhydrazinylidene]oct-2-ene is sourced from PubChem (CID 72722696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).