About N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine
N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine (PubChem CID 138518948) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine.
Molecular Properties
| Compound Name | N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine |
| PubChem CID | 138518948 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine |
| SMILES | CCOC(C)CC/N=C/CC(C)CCC=C(C)C |
| InChI | InChI=1S/C16H31NO/c1-6-18-16(5)11-13-17-12-10-15(4)9-7-8-14(2)3/h8,12,15-16H,6-7,9-11,13H2,1-5H3/b17-12+ |
| InChIKey | QVNGIOXMDFTWCD-SFQUDFHCSA-N |
| XLogP | 4.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine?
The IUPAC name of N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine (CID 138518948) is N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine.
What is the SMILES notation for N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine?
The canonical SMILES for N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine is CCOC(C)CC/N=C/CC(C)CCC=C(C)C.
What is the InChIKey of N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine?
The InChIKey is QVNGIOXMDFTWCD-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H31NO/c1-6-18-16(5)11-13-17-12-10-15(4)9-7-8-14(2)3/h8,12,15-16H,6-7,9-11,13H2,1-5H3/b17-12+.
What are the key properties of N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine?
N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine has a molecular weight of 253.43 g/mol, XLogP of 4.64, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxybutyl)-3,7-dimethyloct-6-en-1-imine is sourced from PubChem (CID 138518948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).