C28H54N2O2 — CID 54612409
N-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine;N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine (PubChem CID 54612409) has the molecular formula C28H54N2O2 and a molecular weight of 450.75 g/mol. Its IUPAC name is N-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine;N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine.
| Compound Name | N-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine;N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 54612409 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | N-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine;N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-ethylethanamine |
| SMILES | CCN(CC)OC/C=C(/C)CCC=C(C)C.CCN(CC)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/2C14H27NO/c2*1-6-15(7-2)16-12-11-14(5)10-8-9-13(3)4/h2*9,11H,6-8,10,12H2,1-5H3/b14-11+;14-11- |
| InChIKey | LFNQTBBOCXMWJT-PENXIKRRSA-N |
| XLogP | 7.91 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|