C23H38O — CID 24775864
(Z)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-ethynyl-2-methyldec-4-ene (PubChem CID 24775864) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (Z)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-ethynyl-2-methyldec-4-ene.
| Compound Name | (Z)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-ethynyl-2-methyldec-4-ene |
|---|---|
| PubChem CID | 24775864 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (Z)-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-ethynyl-2-methyldec-4-ene |
| SMILES | C#C/C(=C\C(OC/C=C(\C)CCC=C(C)C)C(C)C)CCCCC |
| InChI | InChI=1S/C23H38O/c1-8-10-11-15-22(9-2)18-23(20(5)6)24-17-16-21(7)14-12-13-19(3)4/h2,13,16,18,20,23H,8,10-12,14-15,17H2,1,3-7H3/b21-16+,22-18+ |
| InChIKey | KSDDHXXJBGRLKZ-HFXUAKQVSA-N |
| XLogP | 6.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|