C7H15NO3S — CID 130367429
(2S,4R)-4-methoxyhex-5-ene-2-sulfonamide (PubChem CID 130367429) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is (2S,4R)-4-methoxyhex-5-ene-2-sulfonamide.
| Compound Name | (2S,4R)-4-methoxyhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367429 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (2S,4R)-4-methoxyhex-5-ene-2-sulfonamide |
| SMILES | C=C[C@@H](C[C@H](C)S(N)(=O)=O)OC |
| InChI | InChI=1S/C7H15NO3S/c1-4-7(11-3)5-6(2)12(8,9)10/h4,6-7H,1,5H2,2-3H3,(H2,8,9,10)/t6-,7-/m0/s1 |
| InChIKey | PPMZJRVLWBFRCN-BQBZGAKWSA-N |
| XLogP | 0.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|