About 5-methylhex-1-en-3-yl 2,2-dichloroacetate
5-methylhex-1-en-3-yl 2,2-dichloroacetate (PubChem CID 102323553) has the molecular formula C9H14Cl2O2
and a molecular weight of 225.11 g/mol. Its IUPAC name is 5-methylhex-1-en-3-yl 2,2-dichloroacetate.
Molecular Properties
| Compound Name | 5-methylhex-1-en-3-yl 2,2-dichloroacetate |
| PubChem CID | 102323553 |
| Molecular Formula | C9H14Cl2O2 |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-methylhex-1-en-3-yl 2,2-dichloroacetate |
| SMILES | C=CC(CC(C)C)OC(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H14Cl2O2/c1-4-7(5-6(2)3)13-9(12)8(10)11/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | GJQUCRFBMFRXIO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-1-en-3-yl 2,2-dichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-1-en-3-yl 2,2-dichloroacetate?
The IUPAC name of 5-methylhex-1-en-3-yl 2,2-dichloroacetate (CID 102323553) is 5-methylhex-1-en-3-yl 2,2-dichloroacetate.
What is the SMILES notation for 5-methylhex-1-en-3-yl 2,2-dichloroacetate?
The canonical SMILES for 5-methylhex-1-en-3-yl 2,2-dichloroacetate is C=CC(CC(C)C)OC(=O)C(Cl)Cl.
What is the InChIKey of 5-methylhex-1-en-3-yl 2,2-dichloroacetate?
The InChIKey is GJQUCRFBMFRXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Cl2O2/c1-4-7(5-6(2)3)13-9(12)8(10)11/h4,6-8H,1,5H2,2-3H3.
What are the key properties of 5-methylhex-1-en-3-yl 2,2-dichloroacetate?
5-methylhex-1-en-3-yl 2,2-dichloroacetate has a molecular weight of 225.11 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-1-en-3-yl 2,2-dichloroacetate is sourced from PubChem (CID 102323553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).