C8H12Cl2O4 — CID 22803540
(2R)-2-(2,2-dichloroacetyl)oxy-4-methylpentanoic acid (PubChem CID 22803540) has the molecular formula C8H12Cl2O4 and a molecular weight of 243.09 g/mol. Its IUPAC name is (2R)-2-(2,2-dichloroacetyl)oxy-4-methylpentanoic acid.
| Compound Name | (2R)-2-(2,2-dichloroacetyl)oxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22803540 |
| Molecular Formula | C8H12Cl2O4 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (2R)-2-(2,2-dichloroacetyl)oxy-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](OC(=O)C(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H12Cl2O4/c1-4(2)3-5(7(11)12)14-8(13)6(9)10/h4-6H,3H2,1-2H3,(H,11,12)/t5-/m1/s1 |
| InChIKey | ZPZBOOQKVRVBAL-RXMQYKEDSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|