C10H21NO2S — CID 145359201
(4S,6R)-2,6-dimethyloct-7-ene-4-sulfonamide (PubChem CID 145359201) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is (4S,6R)-2,6-dimethyloct-7-ene-4-sulfonamide.
| Compound Name | (4S,6R)-2,6-dimethyloct-7-ene-4-sulfonamide |
|---|---|
| PubChem CID | 145359201 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (4S,6R)-2,6-dimethyloct-7-ene-4-sulfonamide |
| SMILES | C=C[C@H](C)CC(CC(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C10H21NO2S/c1-5-9(4)7-10(6-8(2)3)14(11,12)13/h5,8-10H,1,6-7H2,2-4H3,(H2,11,12,13)/t9-,10?/m0/s1 |
| InChIKey | AFJIIKFVYOXHCE-RGURZIINSA-N |
| XLogP | 1.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|