C8H19N3 — CID 143837437
prop-2-en-1-amine;1-N,1-N',1-N'-trimethylethene-1,1-diamine (PubChem CID 143837437) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is prop-2-en-1-amine;1-N,1-N',1-N'-trimethylethene-1,1-diamine.
| Compound Name | prop-2-en-1-amine;1-N,1-N',1-N'-trimethylethene-1,1-diamine |
|---|---|
| PubChem CID | 143837437 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | prop-2-en-1-amine;1-N,1-N',1-N'-trimethylethene-1,1-diamine |
| SMILES | C=C(NC)N(C)C.C=CCN |
| InChI | InChI=1S/C5H12N2.C3H7N/c1-5(6-2)7(3)4;1-2-3-4/h6H,1H2,2-4H3;2H,1,3-4H2 |
| InChIKey | BZEGGOWTYUWKFK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|