About N-hydroxybut-3-enamide
N-hydroxybut-3-enamide (PubChem CID 11804686) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is N-hydroxybut-3-enamide.
Molecular Properties
| Compound Name | N-hydroxybut-3-enamide |
| PubChem CID | 11804686 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | N-hydroxybut-3-enamide |
| SMILES | C=CCC(=O)NO |
| InChI | InChI=1S/C4H7NO2/c1-2-3-4(6)5-7/h2,7H,1,3H2,(H,5,6) |
| InChIKey | HXGPOWUFZSUKHY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxybut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxybut-3-enamide?
The IUPAC name of N-hydroxybut-3-enamide (CID 11804686) is N-hydroxybut-3-enamide.
What is the SMILES notation for N-hydroxybut-3-enamide?
The canonical SMILES for N-hydroxybut-3-enamide is C=CCC(=O)NO.
What is the InChIKey of N-hydroxybut-3-enamide?
The InChIKey is HXGPOWUFZSUKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-2-3-4(6)5-7/h2,7H,1,3H2,(H,5,6).
What are the key properties of N-hydroxybut-3-enamide?
N-hydroxybut-3-enamide has a molecular weight of 101.10 g/mol, XLogP of 0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxybut-3-enamide is sourced from PubChem (CID 11804686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).