C9H14NaO7P — CID 175328136
sodium;(4-methyl-3-oxopent-4-en-2-yl) dihydrogen phosphate;prop-2-enoate (PubChem CID 175328136) has the molecular formula C9H14NaO7P and a molecular weight of 288.17 g/mol. Its IUPAC name is sodium;(4-methyl-3-oxopent-4-en-2-yl) dihydrogen phosphate;prop-2-enoate.
| Compound Name | sodium;(4-methyl-3-oxopent-4-en-2-yl) dihydrogen phosphate;prop-2-enoate |
|---|---|
| PubChem CID | 175328136 |
| Molecular Formula | C9H14NaO7P |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | sodium;(4-methyl-3-oxopent-4-en-2-yl) dihydrogen phosphate;prop-2-enoate |
| SMILES | C=C(C)C(=O)C(C)OP(=O)(O)O.C=CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H11O5P.C3H4O2.Na/c1-4(2)6(7)5(3)11-12(8,9)10;1-2-3(4)5;/h5H,1H2,2-3H3,(H2,8,9,10);2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | MWGAWTTYLBELRN-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|