C20H39NO4 — CID 91168181
[3-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]dodecan-2-yl] acetate (PubChem CID 91168181) has the molecular formula C20H39NO4 and a molecular weight of 357.54 g/mol. Its IUPAC name is [3-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]dodecan-2-yl] acetate.
| Compound Name | [3-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]dodecan-2-yl] acetate |
|---|---|
| PubChem CID | 91168181 |
| Molecular Formula | C20H39NO4 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | [3-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]dodecan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(C)CCCCCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO4/c1-16(17(2)24-18(3)22)14-12-10-8-7-9-11-13-15-21-19(23)25-20(4,5)6/h16-17H,7-15H2,1-6H3,(H,21,23) |
| InChIKey | IJDQUJDMGOSLSQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|