C14H28N2O5 — CID 153452651
methyl 2-[1-(hydroxyamino)ethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 153452651) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 2-[1-(hydroxyamino)ethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl 2-[1-(hydroxyamino)ethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 153452651 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl 2-[1-(hydroxyamino)ethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)OC(C)(C)C)C(C)NO |
| InChI | InChI=1S/C14H28N2O5/c1-10(16-19)11(12(17)20-5)8-6-7-9-15-13(18)21-14(2,3)4/h10-11,16,19H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | SPBGMHVIVUVYPA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|