C15H30N2O4 — CID 22635139
ethyl N-[7-(ethoxycarbonylamino)-2,3-dimethylheptan-2-yl]carbamate (PubChem CID 22635139) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is ethyl N-[7-(ethoxycarbonylamino)-2,3-dimethylheptan-2-yl]carbamate.
| Compound Name | ethyl N-[7-(ethoxycarbonylamino)-2,3-dimethylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 22635139 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | ethyl N-[7-(ethoxycarbonylamino)-2,3-dimethylheptan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(C)C(C)(C)NC(=O)OCC |
| InChI | InChI=1S/C15H30N2O4/c1-6-20-13(18)16-11-9-8-10-12(3)15(4,5)17-14(19)21-7-2/h12H,6-11H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | ZNZHQSWNLWOILJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|