C26H49NO3 — CID 135302756
N-(7,7,10,10,14,14-hexamethyl-6,11-dioxopentadecyl)-2,2-dimethylpropanamide (PubChem CID 135302756) has the molecular formula C26H49NO3 and a molecular weight of 423.68 g/mol. Its IUPAC name is N-(7,7,10,10,14,14-hexamethyl-6,11-dioxopentadecyl)-2,2-dimethylpropanamide.
| Compound Name | N-(7,7,10,10,14,14-hexamethyl-6,11-dioxopentadecyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 135302756 |
| Molecular Formula | C26H49NO3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.37 |
| IUPAC Name | N-(7,7,10,10,14,14-hexamethyl-6,11-dioxopentadecyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)CCC(=O)C(C)(C)CCC(C)(C)C(=O)CCCCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H49NO3/c1-23(2,3)16-15-21(29)26(9,10)18-17-25(7,8)20(28)14-12-11-13-19-27-22(30)24(4,5)6/h11-19H2,1-10H3,(H,27,30) |
| InChIKey | GLXSHJBMBQRZDO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|