C14H25NO2 — CID 15883436
N-(5-cyclobutyl-5-oxopentyl)-2,2-dimethylpropanamide (PubChem CID 15883436) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-(5-cyclobutyl-5-oxopentyl)-2,2-dimethylpropanamide.
| Compound Name | N-(5-cyclobutyl-5-oxopentyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 15883436 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-(5-cyclobutyl-5-oxopentyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCCC(=O)C1CCC1 |
| InChI | InChI=1S/C14H25NO2/c1-14(2,3)13(17)15-10-5-4-9-12(16)11-7-6-8-11/h11H,4-10H2,1-3H3,(H,15,17) |
| InChIKey | BAXOMZRAIKGHPH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|