C21H38N2O2 — CID 40601025
N-[(4S)-4-[(cyclobutanecarbonylamino)methyl]-4-ethyloctyl]cyclobutanecarboxamide (PubChem CID 40601025) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is N-[(4S)-4-[(cyclobutanecarbonylamino)methyl]-4-ethyloctyl]cyclobutanecarboxamide.
| Compound Name | N-[(4S)-4-[(cyclobutanecarbonylamino)methyl]-4-ethyloctyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 40601025 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | N-[(4S)-4-[(cyclobutanecarbonylamino)methyl]-4-ethyloctyl]cyclobutanecarboxamide |
| SMILES | CCCC[C@@](CC)(CCCNC(=O)C1CCC1)CNC(=O)C1CCC1 |
| InChI | InChI=1S/C21H38N2O2/c1-3-5-13-21(4-2,16-23-20(25)18-11-7-12-18)14-8-15-22-19(24)17-9-6-10-17/h17-18H,3-16H2,1-2H3,(H,22,24)(H,23,25)/t21-/m0/s1 |
| InChIKey | ITCVHAUQQJBPOD-NRFANRHFSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|