C8H9F3N2O — CID 125476744
N-[(E,2R)-1-cyanopent-3-en-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 125476744) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is N-[(E,2R)-1-cyanopent-3-en-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,2R)-1-cyanopent-3-en-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 125476744 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-[(E,2R)-1-cyanopent-3-en-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C/C=C/[C@@H](CC#N)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O/c1-2-3-6(4-5-12)13-7(14)8(9,10)11/h2-3,6H,4H2,1H3,(H,13,14)/b3-2+/t6-/m0/s1 |
| InChIKey | VWSVUTOIFUKOTA-SZKDQXIBSA-N |
| XLogP | 1.52 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|