C13H20F3NO3 — CID 71729102
tert-butyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate (PubChem CID 71729102) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is tert-butyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate.
| Compound Name | tert-butyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
|---|---|
| PubChem CID | 71729102 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
| SMILES | CCC[C@@H](/C=C/C(=O)OC(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-5-6-9(17-11(19)13(14,15)16)7-8-10(18)20-12(2,3)4/h7-9H,5-6H2,1-4H3,(H,17,19)/b8-7+/t9-/m0/s1 |
| InChIKey | WFYOMTCQMRIQLB-FLOXNTQESA-N |
| XLogP | 2.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|