C13H26N2O2 — CID 88922406
1-tert-butyl-3-(2,2-dimethyl-4-oxohexan-3-yl)urea (PubChem CID 88922406) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2-dimethyl-4-oxohexan-3-yl)urea.
| Compound Name | 1-tert-butyl-3-(2,2-dimethyl-4-oxohexan-3-yl)urea |
|---|---|
| PubChem CID | 88922406 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-tert-butyl-3-(2,2-dimethyl-4-oxohexan-3-yl)urea |
| SMILES | CCC(=O)C(NC(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-8-9(16)10(12(2,3)4)14-11(17)15-13(5,6)7/h10H,8H2,1-7H3,(H2,14,15,17) |
| InChIKey | OFOLUFPSTZEEKO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |