C6H13N4OY- — CID 168847602
[N-(tert-butylcarbamoyl)carbamimidoyl]azanide;yttrium (PubChem CID 168847602) has the molecular formula C6H13N4OY- and a molecular weight of 246.10 g/mol. Its IUPAC name is [N-(tert-butylcarbamoyl)carbamimidoyl]azanide;yttrium.
| Compound Name | [N-(tert-butylcarbamoyl)carbamimidoyl]azanide;yttrium |
|---|---|
| PubChem CID | 168847602 |
| Molecular Formula | C6H13N4OY- |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | [N-(tert-butylcarbamoyl)carbamimidoyl]azanide;yttrium |
| SMILES | [H]/N=C(\[NH-])NC(=O)NC(C)(C)C.[Y] |
| InChI | InChI=1S/C6H14N4O.Y/c1-6(2,3)10-5(11)9-4(7)8;/h1-3H3,(H5,7,8,9,10,11);/p-1 |
| InChIKey | BVNYWZORVRIROW-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|