C28H45ClN8O2 — CID 173433968
1-tert-butyl-3-[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;hydrochloride (PubChem CID 173433968) has the molecular formula C28H45ClN8O2 and a molecular weight of 561.18 g/mol. Its IUPAC name is 1-tert-butyl-3-[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;hydrochloride.
| Compound Name | 1-tert-butyl-3-[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;hydrochloride |
|---|---|
| PubChem CID | 173433968 |
| Molecular Formula | C28H45ClN8O2 |
| Molecular Weight | 561.18 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 1-tert-butyl-3-[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;[N-methyl-N-(2,4,6-trimethylphenyl)carbamimidoyl]urea;hydrochloride |
| SMILES | Cl.[H]/N=C(\NC(=O)NC(C)(C)C)N(C)c1c(C)cc(C)cc1C.[H]/N=C(\NC(N)=O)N(C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H26N4O.C12H18N4O.ClH/c1-10-8-11(2)13(12(3)9-10)20(7)14(17)18-15(21)19-16(4,5)6;1-7-5-8(2)10(9(3)6-7)16(4)11(13)15-12(14)17;/h8-9H,1-7H3,(H3,17,18,19,21);5-6H,1-4H3,(H4,13,14,15,17);1H |
| InChIKey | YRNYPLSLZSMANQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|