C25H34F2N6O — CID 57152046
3-tert-butyl-1,1-bis[N-(4-fluoro-2,6-dimethylphenyl)-N-methylcarbamimidoyl]urea (PubChem CID 57152046) has the molecular formula C25H34F2N6O and a molecular weight of 472.58 g/mol. Its IUPAC name is 3-tert-butyl-1,1-bis[N-(4-fluoro-2,6-dimethylphenyl)-N-methylcarbamimidoyl]urea.
| Compound Name | 3-tert-butyl-1,1-bis[N-(4-fluoro-2,6-dimethylphenyl)-N-methylcarbamimidoyl]urea |
|---|---|
| PubChem CID | 57152046 |
| Molecular Formula | C25H34F2N6O |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-tert-butyl-1,1-bis[N-(4-fluoro-2,6-dimethylphenyl)-N-methylcarbamimidoyl]urea |
| SMILES | [H]/N=C(\N(C(=O)NC(C)(C)C)/C(=N/[H])N(C)c1c(C)cc(F)cc1C)N(C)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C25H34F2N6O/c1-14-10-18(26)11-15(2)20(14)31(8)22(28)33(24(34)30-25(5,6)7)23(29)32(9)21-16(3)12-19(27)13-17(21)4/h10-13,28-29H,1-9H3,(H,30,34)/b28-22-,29-23+ |
| InChIKey | CZEODYIDQXXCCN-XWFWGDPBSA-N |
| XLogP | 5.45 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|