C15H24N2O — CID 115169017
1-(4-tert-butyl-2,6-dimethylphenyl)-1,3-dimethylurea (PubChem CID 115169017) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)-1,3-dimethylurea.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169017 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H24N2O/c1-10-8-12(15(3,4)5)9-11(2)13(10)17(7)14(18)16-6/h8-9H,1-7H3,(H,16,18) |
| InChIKey | JIXNYEOQQOWYNO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |