C14H20FN3O2 — CID 23275444
1-[(5-tert-butyl-2-fluorophenyl)carbamoyl]-1,3-dimethylurea (PubChem CID 23275444) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-[(5-tert-butyl-2-fluorophenyl)carbamoyl]-1,3-dimethylurea.
| Compound Name | 1-[(5-tert-butyl-2-fluorophenyl)carbamoyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 23275444 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[(5-tert-butyl-2-fluorophenyl)carbamoyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C(=O)Nc1cc(C(C)(C)C)ccc1F |
| InChI | InChI=1S/C14H20FN3O2/c1-14(2,3)9-6-7-10(15)11(8-9)17-13(20)18(5)12(19)16-4/h6-8H,1-5H3,(H,16,19)(H,17,20) |
| InChIKey | BUUKILVEWOAVFB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |