C10H13BrN2O — CID 115169063
1-(5-bromo-2-methylphenyl)-1,3-dimethylurea (PubChem CID 115169063) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-1,3-dimethylurea.
| Compound Name | 1-(5-bromo-2-methylphenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169063 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1cc(Br)ccc1C |
| InChI | InChI=1S/C10H13BrN2O/c1-7-4-5-8(11)6-9(7)13(3)10(14)12-2/h4-6H,1-3H3,(H,12,14) |
| InChIKey | LQAVVEAFBYTEBZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |