C12H18N2O — CID 115169018
1,3-dimethyl-1-(2,4,5-trimethylphenyl)urea (PubChem CID 115169018) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,3-dimethyl-1-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1,3-dimethyl-1-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 115169018 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1,3-dimethyl-1-(2,4,5-trimethylphenyl)urea |
| SMILES | CNC(=O)N(C)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C12H18N2O/c1-8-6-10(3)11(7-9(8)2)14(5)12(15)13-4/h6-7H,1-5H3,(H,13,15) |
| InChIKey | RNRGMSXRBBQSJZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |