3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid

C15H21NO3 — CID 115164533

IUPAC3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid
SMILESCc1cc(C)c(N(C)C(=O)C(C)CC(=O)O)cc1C
InChIInChI=1S/C15H21NO3/c1-9-6-11(3)13(7-10(9)2)16(5)15(19)12(4)8-14(17)18/h6-7,12H,8H2,1-5H3,(H,17,18)
InChIKeyUKBUOKLTJFTHKJ-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.69
Rot. Bonds4

About 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid

3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid (PubChem CID 115164533) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid.

Molecular Properties

Compound Name3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid
PubChem CID115164533
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid
SMILESCc1cc(C)c(N(C)C(=O)C(C)CC(=O)O)cc1C
InChIInChI=1S/C15H21NO3/c1-9-6-11(3)13(7-10(9)2)16(5)15(19)12(4)8-14(17)18/h6-7,12H,8H2,1-5H3,(H,17,18)
InChIKeyUKBUOKLTJFTHKJ-UHFFFAOYSA-N
XLogP2.69
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid?
The IUPAC name of 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid (CID 115164533) is 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid.
What is the SMILES notation for 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid?
The canonical SMILES for 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid is Cc1cc(C)c(N(C)C(=O)C(C)CC(=O)O)cc1C.
What is the InChIKey of 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid?
The InChIKey is UKBUOKLTJFTHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-9-6-11(3)13(7-10(9)2)16(5)15(19)12(4)8-14(17)18/h6-7,12H,8H2,1-5H3,(H,17,18).
What are the key properties of 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid?
3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-oxo-4-(N,2,4,5-tetramethylanilino)butanoic acid is sourced from PubChem (CID 115164533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).