C7H10N4O — CID 166732350
1,3-dimethyl-1-pyrimidin-2-ylurea (PubChem CID 166732350) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,3-dimethyl-1-pyrimidin-2-ylurea.
| Compound Name | 1,3-dimethyl-1-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 166732350 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1,3-dimethyl-1-pyrimidin-2-ylurea |
| SMILES | CNC(=O)N(C)c1ncccn1 |
| InChI | InChI=1S/C7H10N4O/c1-8-7(12)11(2)6-9-4-3-5-10-6/h3-5H,1-2H3,(H,8,12) |
| InChIKey | BWXXTGKWXRQFBV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |