C9H12N2O2 — CID 115281222
1-(4-hydroxyphenyl)-1,3-dimethylurea (PubChem CID 115281222) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-1,3-dimethylurea.
| Compound Name | 1-(4-hydroxyphenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 115281222 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-(4-hydroxyphenyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H12N2O2/c1-10-9(13)11(2)7-3-5-8(12)6-4-7/h3-6,12H,1-2H3,(H,10,13) |
| InChIKey | QOLREYPRBXZBDI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |