C14H14N2O4 — CID 108895520
3-(3,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-1-methylurea (PubChem CID 108895520) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-1-methylurea.
| Compound Name | 3-(3,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 108895520 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(3,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1cc(O)cc(O)c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-16(10-2-4-11(17)5-3-10)14(20)15-9-6-12(18)8-13(19)7-9/h2-8,17-19H,1H3,(H,15,20) |
| InChIKey | FIOXUHCDMZHOOK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |