C9H18N4O3S — CID 21442168
methyl N-(tert-butylcarbamoyl)-N-(methylsulfanylcarbamoyl)carbamimidate (PubChem CID 21442168) has the molecular formula C9H18N4O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is methyl N-(tert-butylcarbamoyl)-N-(methylsulfanylcarbamoyl)carbamimidate.
| Compound Name | methyl N-(tert-butylcarbamoyl)-N-(methylsulfanylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 21442168 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl N-(tert-butylcarbamoyl)-N-(methylsulfanylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NSC)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H18N4O3S/c1-9(2,3)11-7(14)13(6(10)16-4)8(15)12-17-5/h10H,1-5H3,(H,11,14)(H,12,15)/b10-6- |
| InChIKey | SSVBUSNURBDDRN-POHAHGRESA-N |
| XLogP | 1.37 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|