C11H20N4O5 — CID 21442300
methyl 2-[[tert-butylcarbamoyl-(C-methoxycarbonimidoyl)carbamoyl]amino]acetate (PubChem CID 21442300) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 2-[[tert-butylcarbamoyl-(C-methoxycarbonimidoyl)carbamoyl]amino]acetate.
| Compound Name | methyl 2-[[tert-butylcarbamoyl-(C-methoxycarbonimidoyl)carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 21442300 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl 2-[[tert-butylcarbamoyl-(C-methoxycarbonimidoyl)carbamoyl]amino]acetate |
| SMILES | [H]/N=C(\OC)N(C(=O)NCC(=O)OC)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H20N4O5/c1-11(2,3)14-10(18)15(8(12)20-5)9(17)13-6-7(16)19-4/h12H,6H2,1-5H3,(H,13,17)(H,14,18)/b12-8- |
| InChIKey | WQPDDNZCAVCOIE-WQLSENKSSA-N |
| XLogP | 0.26 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|