C5H10N4O3S — CID 21441996
methyl N-carbamoyl-N-(methylsulfanylcarbamoyl)carbamimidate (PubChem CID 21441996) has the molecular formula C5H10N4O3S and a molecular weight of 206.23 g/mol. Its IUPAC name is methyl N-carbamoyl-N-(methylsulfanylcarbamoyl)carbamimidate.
| Compound Name | methyl N-carbamoyl-N-(methylsulfanylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 21441996 |
| Molecular Formula | C5H10N4O3S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | methyl N-carbamoyl-N-(methylsulfanylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(N)=O)C(=O)NSC |
| InChI | InChI=1S/C5H10N4O3S/c1-12-4(7)9(3(6)10)5(11)8-13-2/h7H,1-2H3,(H2,6,10)(H,8,11)/b7-4- |
| InChIKey | NGFOKQJLTVDGMG-DAXSKMNVSA-N |
| XLogP | -0.06 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|