C10H20N4O2S2 — CID 21442312
methyl N-(propan-2-ylcarbamothioyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate (PubChem CID 21442312) has the molecular formula C10H20N4O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is methyl N-(propan-2-ylcarbamothioyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate.
| Compound Name | methyl N-(propan-2-ylcarbamothioyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 21442312 |
| Molecular Formula | C10H20N4O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | methyl N-(propan-2-ylcarbamothioyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NSC(C)C)C(=S)NC(C)C |
| InChI | InChI=1S/C10H20N4O2S2/c1-6(2)12-10(17)14(8(11)16-5)9(15)13-18-7(3)4/h6-7,11H,1-5H3,(H,12,17)(H,13,15)/b11-8- |
| InChIKey | VZUVAYFLKCWEBJ-FLIBITNWSA-N |
| XLogP | 1.92 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|